Cách tốt nhất để thay đổi màu nền cho NSView

Tôi đang tìm cách tốt nhất để thay đổi backgroundColormột NSView. Tôi cũng muốn có thể đặt alphamặt nạ thích hợp cho NSView. Cái gì đó như:

myView.backgroundColor = [NSColor colorWithCalibratedRed:0.227f 
                                                   green:0.251f 
                                                    blue:0.337 
                                                   alpha:0.8];

Tôi nhận thấy rằng NSWindowcó phương pháp này và tôi không phải là một fan hâm mộ lớn của các tùy chọn NSColorWheelhoặc NSImagenền, nhưng nếu chúng là tốt nhất, sẵn sàng sử dụng.

Vâng, câu trả lời của riêng bạn là đúng. Bạn cũng có thể sử dụng các phương pháp ca cao:

- (void)drawRect:(NSRect)dirtyRect {
    // set any NSColor for filling, say white:
    [[NSColor whiteColor] setFill];
    NSRectFill(dirtyRect);
    [super drawRect:dirtyRect];
}

Trong Swift:

class MyView: NSView {

    override func draw(_ dirtyRect: NSRect) {
        super.draw(dirtyRect)

        // #1d161d
        NSColor(red: 0x1d/255, green: 0x16/255, blue: 0x1d/255, alpha: 1).setFill()
        dirtyRect.fill()
    }

}

Một giải pháp dễ dàng, hiệu quả là cấu hình chế độ xem để sử dụng lớp Core Animation làm kho lưu trữ dự phòng. Sau đó, bạn có thể sử dụng -[CALayer setBackgroundColor:]để đặt màu nền của lớp.

- (void)awakeFromNib {
   self.wantsLayer = YES;  // NSView will create a CALayer automatically
}

- (BOOL)wantsUpdateLayer {
   return YES;  // Tells NSView to call `updateLayer` instead of `drawRect:`
}

- (void)updateLayer {
   self.layer.backgroundColor = [NSColor colorWithCalibratedRed:0.227f 
                                                          green:0.251f 
                                                           blue:0.337 
                                                          alpha:0.8].CGColor;
}

Đó là nó!

Nếu bạn là người yêu thích kịch bản, đây là một cách mà bạn không cần bất kỳ dòng mã nào .

Thêm NSBoxdưới dạng một khung nhìn phụ vào NSView và điều chỉnh khung của NSBox giống như với NSView.

Trong Storyboard hoặc XIB, thay đổi vị trí Tiêu đề thành Không có, Loại hộp thành Tùy chỉnh , Loại viền thành "Không" và Màu viền thành bất cứ thứ gì bạn thích.

Đây là một ảnh chụp màn hình:

Đây là kết quả:

Nếu bạn đặtWantsLayer thành CÓ trước, bạn có thể thao tác trực tiếp với lớp nền.

[self.view setWantsLayer:YES];
[self.view.layer setBackgroundColor:[[NSColor whiteColor] CGColor]];

Nghĩ rằng tôi đã tìm ra cách để làm điều đó:

- (void)drawRect:(NSRect)dirtyRect {
    // Fill in background Color
    CGContextRef context = (CGContextRef) [[NSGraphicsContext currentContext] graphicsPort];
    CGContextSetRGBFillColor(context, 0.227,0.251,0.337,0.8);
    CGContextFillRect(context, NSRectToCGRect(dirtyRect));
}

Tôi đã xem qua tất cả những câu trả lời này và không ai trong số chúng làm việc cho tôi một cách đáng tiếc. Tuy nhiên, tôi tìm thấy cách cực kỳ đơn giản này, sau khoảng một giờ tìm kiếm :)

myView.layer.backgroundColor = CGColorCreateGenericRGB(0, 0, 0, 0.9);

chỉnh sửa / cập nhật: Xcode 8.3.1 • Swift 3.1

extension NSView {
    var backgroundColor: NSColor? {
        get {
            guard let color = layer?.backgroundColor else { return nil }
            return NSColor(cgColor: color)
        }
        set {
            wantsLayer = true
            layer?.backgroundColor = newValue?.cgColor
        }
    }
}

sử dụng:

let myView = NSView(frame: NSRect(x: 0, y: 0, width: 100, height: 100))
print(myView.backgroundColor ?? "none")     //  NSView's background hasn't been set yet = nil
myView.backgroundColor = .red               // set NSView's background color to red color
print(myView.backgroundColor ?? "none")
view.addSubview(myView)

Giải pháp tốt nhất :

- (id)initWithFrame:(NSRect)frame
{
    self = [super initWithFrame:frame];
    if (self)
    {
        self.wantsLayer = YES;
    }
    return self;
}

- (void)awakeFromNib
{
    float r = (rand() % 255) / 255.0f;
    float g = (rand() % 255) / 255.0f;
    float b = (rand() % 255) / 255.0f;

    if(self.layer)
    {
        CGColorRef color = CGColorCreateGenericRGB(r, g, b, 1.0f);
        self.layer.backgroundColor = color;
        CGColorRelease(color);
    }
}

Trong Swift:

override func drawRect(dirtyRect: NSRect) {

    NSColor.greenColor().setFill()
    NSRectFill(dirtyRect)

    super.drawRect(dirtyRect)
}

Sử dụng NSBox, một lớp con của NSView, cho phép chúng tôi dễ dàng tạo kiểu

Swift 3

let box = NSBox()
box.boxType = .custom
box.fillColor = NSColor.red
box.cornerRadius = 5

Không nghi ngờ gì là cách dễ nhất, cũng tương thích với Tài sản tập màu:

Swift :

view.setValue(NSColor.white, forKey: "backgroundColor")

Mục tiêu-C :

[view setValue: NSColor.whiteColor forKey: "backgroundColor"];

Trình tạo giao diện :

Thêm một thuộc tính do người dùng định nghĩa backgroundColortrong trình xây dựng giao diện, loại NSColor.

Tôi đã thử nghiệm những điều sau đây và nó hoạt động với tôi (trong Swift):

view.wantsLayer = true
view.layer?.backgroundColor = NSColor.blackColor().colorWithAlphaComponent(0.5).CGColor

Trong Swift 3, bạn có thể tạo tiện ích mở rộng để thực hiện:

extension NSView {
    func setBackgroundColor(_ color: NSColor) {
        wantsLayer = true
        layer?.backgroundColor = color.cgColor
    }
}

// how to use
btn.setBackgroundColor(NSColor.gray)

Có một cái nhìn tại RMSkinnedView . Bạn có thể đặt màu nền của NSView từ bên trong Trình tạo giao diện.

Trong swift, bạn có thể phân lớp NSView và làm điều này

class MyView:NSView {
    required init?(coder: NSCoder) {
        super.init(coder: coder);

        self.wantsLayer = true;
        self.layer?.backgroundColor = NSColor.redColor().CGColor;
    }
}

Chỉ là lớp tái sử dụng nhỏ (Swift 4.1)

class View: NSView {

   var backgroundColor: NSColor?

   convenience init() {
      self.init(frame: NSRect())
   }

   override func draw(_ dirtyRect: NSRect) {
      if let backgroundColor = backgroundColor {
         backgroundColor.setFill()
         dirtyRect.fill()
      } else {
         super.draw(dirtyRect)
      }
   }
}

// Usage
let view = View()
view.backgroundColor = .white

Chỉ cần đặt backgroundColortrên lớp (sau khi thực hiện lớp xem lại).

view.wantsLayer = true
view.layer?.backgroundColor = CGColor.white

Điều này hỗ trợ thay đổi giao diện toàn hệ thống (bật hoặc tắt chế độ tối) trong khi ứng dụng đang chạy. Bạn cũng có thể đặt màu nền trong Trình tạo giao diện, nếu bạn đặt lớp của chế độ xem thành BackgroundColorView trước.

class BackgroundColorView: NSView {
    @IBInspectable var backgroundColor: NSColor? {
        didSet { needsDisplay = true }
    }

    override init(frame frameRect: NSRect) {
        super.init(frame: frameRect)
        wantsLayer = true
    }

    required init?(coder decoder: NSCoder) {
        super.init(coder: decoder)
        wantsLayer = true
    }

    override var wantsUpdateLayer: Bool { return true }

    override func updateLayer() {
        layer?.backgroundColor = backgroundColor?.cgColor
    }
}